Difference between revisions of "CPD-9091"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite SULFO-CYSTEINE == * common-name: ** s-sulfo-l-cysteine * smiles: ** c(c([n+])c(=o)[o-])ss([o-])(=o)=o * inchi-key: ** nokpbjyhphhwan-reoh...")
(Created page with "Category:metabolite == Metabolite CPD-9091 == * smiles: ** cc=c5(c(c)c9(n6([mg]27(n1(c(c(c)c(ccc(=o)occ=c(c)cccc(c)cccc(c)cccc(c)c)c=1c4([c-](c(oc)=o)c(=o)c3(=c(c)c(n2c3=4...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite SULFO-CYSTEINE ==
+
== Metabolite CPD-9091 ==
 +
* smiles:
 +
** cc=c5(c(c)c9(n6([mg]27(n1(c(c(c)c(ccc(=o)occ=c(c)cccc(c)cccc(c)cccc(c)c)c=1c4([c-](c(oc)=o)c(=o)c3(=c(c)c(n2c3=4)=cc5=6)))=cc8(=c(c)c(c(c)=o)=c(n78)c=9))))))
 
* common-name:
 
* common-name:
** s-sulfo-l-cysteine
+
** bacteriochlorophyll b
* smiles:
 
** c(c([n+])c(=o)[o-])ss([o-])(=o)=o
 
* inchi-key:
 
** nokpbjyhphhwan-reohclbhsa-m
 
 
* molecular-weight:
 
* molecular-weight:
** 200.204
+
** 908.494
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[SULFOCYS-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[SULFOCYS-RXN]]
+
* [[RXN-17482]]
 +
* [[RXN-17483]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=s-sulfo-l-cysteine}}
+
{{#set: common-name=bacteriochlorophyll b}}
{{#set: inchi-key=inchikey=nokpbjyhphhwan-reohclbhsa-m}}
+
{{#set: molecular-weight=908.494}}
{{#set: molecular-weight=200.204}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-9091

  • smiles:
    • cc=c5(c(c)c9(n6([mg]27(n1(c(c(c)c(ccc(=o)occ=c(c)cccc(c)cccc(c)cccc(c)c)c=1c4([c-](c(oc)=o)c(=o)c3(=c(c)c(n2c3=4)=cc5=6)))=cc8(=c(c)c(c(c)=o)=c(n78)c=9))))))
  • common-name:
    • bacteriochlorophyll b
  • molecular-weight:
    • 908.494

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality