Difference between revisions of "CPD-9091"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14447 == * common-name: ** (2z)-2-hydroxypenta-2,4-dienoate * smiles: ** c=cc=c(c([o-])=o)o * inchi-key: ** vhtqqdxpnutmnb-arjawskdsa...") |
(Created page with "Category:metabolite == Metabolite SULFO-CYSTEINE == * common-name: ** s-sulfo-l-cysteine * smiles: ** c(c([n+])c(=o)[o-])ss([o-])(=o)=o * inchi-key: ** nokpbjyhphhwan-reoh...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite SULFO-CYSTEINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** s-sulfo-l-cysteine |
* smiles: | * smiles: | ||
| − | ** c | + | ** c(c([n+])c(=o)[o-])ss([o-])(=o)=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** nokpbjyhphhwan-reohclbhsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 200.204 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[SULFOCYS-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[SULFOCYS-RXN]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=s-sulfo-l-cysteine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=nokpbjyhphhwan-reohclbhsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=200.204}} |
Revision as of 14:57, 5 January 2021
Contents
Metabolite SULFO-CYSTEINE
- common-name:
- s-sulfo-l-cysteine
- smiles:
- c(c([n+])c(=o)[o-])ss([o-])(=o)=o
- inchi-key:
- nokpbjyhphhwan-reohclbhsa-m
- molecular-weight:
- 200.204
