Difference between revisions of "CPD-9091"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9925 == * common-name: ** 1,4-dihydroxy-2-naphthoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(c2(c=c(o)c1(=cc=cc=c1c(o)=2)))=o)co...")
(Created page with "Category:metabolite == Metabolite Protein-Phosphoserines == * common-name: ** a [protein] l-serine phosphate == Reaction(s) known to consume the compound == * 2.7.12.1-R...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9925 ==
+
== Metabolite Protein-Phosphoserines ==
 
* common-name:
 
* common-name:
** 1,4-dihydroxy-2-naphthoyl-coa
+
** a [protein] l-serine phosphate
* smiles:
 
** cc(c)(c(o)c(=o)nccc(=o)nccsc(c2(c=c(o)c1(=cc=cc=c1c(o)=2)))=o)cop(=o)(op(=o)(occ3(c(op([o-])(=o)[o-])c(o)c(o3)n5(c4(=c(c(n)=nc=n4)n=c5))))[o-])[o-]
 
* inchi-key:
 
** pytinlgpkdjurz-hsjnekgzsa-j
 
* molecular-weight:
 
** 949.669
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[2.7.12.1-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[NAPHTHOATE-SYN-RXN]]
+
* [[2.7.12.1-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1,4-dihydroxy-2-naphthoyl-coa}}
+
{{#set: common-name=a [protein] l-serine phosphate}}
{{#set: inchi-key=inchikey=pytinlgpkdjurz-hsjnekgzsa-j}}
 
{{#set: molecular-weight=949.669}}
 

Revision as of 18:56, 14 January 2021

Metabolite Protein-Phosphoserines

  • common-name:
    • a [protein] l-serine phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [protein] l-serine phosphate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.