Difference between revisions of "CPD-9098"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ07017 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * 4.2.2.10-RXN ** Catego...") |
(Created page with "Category:metabolite == Metabolite CPD-9098 == * common-name: ** geranylgeranyl bacteriopheophytin * smiles: ** ccc1(c(c3(n=c1c=c2(nc6(c(=c2c)c([c-](c(c5(=nc(=cc4(nc(c=3)=c...") |
||
| (8 intermediate revisions by 4 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-9098 == |
| − | == | + | * common-name: |
| − | + | ** geranylgeranyl bacteriopheophytin | |
| − | == | + | * smiles: |
| − | * | + | ** ccc1(c(c3(n=c1c=c2(nc6(c(=c2c)c([c-](c(c5(=nc(=cc4(nc(c=3)=c(c=4c)c(=o)c))c(c5ccc(=o)occ=c(ccc=c(ccc=c(ccc=c(c)c)c)c)c)c))=6)c(oc)=o)=o))))c) |
| − | + | * inchi-key: | |
| − | ** | + | ** ijmymfmuuouget-riziqltbsa-n |
| − | * | + | * molecular-weight: |
| − | + | ** 882.173 | |
| − | ** | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-17427]] |
| − | + | * [[RXN-8794]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * [[RXN- | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=geranylgeranyl bacteriopheophytin}} | |
| − | + | {{#set: inchi-key=inchikey=ijmymfmuuouget-riziqltbsa-n}} | |
| − | == | + | {{#set: molecular-weight=882.173}} |
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | {{#set: | ||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-9098
- common-name:
- geranylgeranyl bacteriopheophytin
- smiles:
- ccc1(c(c3(n=c1c=c2(nc6(c(=c2c)c([c-](c(c5(=nc(=cc4(nc(c=3)=c(c=4c)c(=o)c))c(c5ccc(=o)occ=c(ccc=c(ccc=c(ccc=c(c)c)c)c)c)c))=6)c(oc)=o)=o))))c)
- inchi-key:
- ijmymfmuuouget-riziqltbsa-n
- molecular-weight:
- 882.173
