Difference between revisions of "CPD-9098"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-511 == * common-name: ** pantetheine * smiles: ** cc(c(o)c(=o)nccc(nccs)=o)(c)co * inchi-key: ** znxzgrmvnnhpca-vifpvbqesa-n * molecu...")
(Created page with "Category:metabolite == Metabolite CPD-9098 == * common-name: ** geranylgeranyl bacteriopheophytin * smiles: ** ccc1(c(c3(n=c1c=c2(nc6(c(=c2c)c([c-](c(c5(=nc(=cc4(nc(c=3)=c...")
 
(4 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-511 ==
+
== Metabolite CPD-9098 ==
 
* common-name:
 
* common-name:
** pantetheine
+
** geranylgeranyl bacteriopheophytin
 
* smiles:
 
* smiles:
** cc(c(o)c(=o)nccc(nccs)=o)(c)co
+
** ccc1(c(c3(n=c1c=c2(nc6(c(=c2c)c([c-](c(c5(=nc(=cc4(nc(c=3)=c(c=4c)c(=o)c))c(c5ccc(=o)occ=c(ccc=c(ccc=c(ccc=c(c)c)c)c)c)c))=6)c(oc)=o)=o))))c)
 
* inchi-key:
 
* inchi-key:
** znxzgrmvnnhpca-vifpvbqesa-n
+
** ijmymfmuuouget-riziqltbsa-n
 
* molecular-weight:
 
* molecular-weight:
** 278.366
+
** 882.173
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PANTETHEINE-KINASE-RXN]]
+
* [[RXN-17427]]
 +
* [[RXN-8794]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PANTETHEINE-KINASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=pantetheine}}
+
{{#set: common-name=geranylgeranyl bacteriopheophytin}}
{{#set: inchi-key=inchikey=znxzgrmvnnhpca-vifpvbqesa-n}}
+
{{#set: inchi-key=inchikey=ijmymfmuuouget-riziqltbsa-n}}
{{#set: molecular-weight=278.366}}
+
{{#set: molecular-weight=882.173}}

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-9098

  • common-name:
    • geranylgeranyl bacteriopheophytin
  • smiles:
    • ccc1(c(c3(n=c1c=c2(nc6(c(=c2c)c([c-](c(c5(=nc(=cc4(nc(c=3)=c(c=4c)c(=o)c))c(c5ccc(=o)occ=c(ccc=c(ccc=c(ccc=c(c)c)c)c)c)c))=6)c(oc)=o)=o))))c)
  • inchi-key:
    • ijmymfmuuouget-riziqltbsa-n
  • molecular-weight:
    • 882.173

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality