Difference between revisions of "CPD-9098"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9098 == * common-name: ** geranylgeranyl bacteriopheophytin * smiles: ** ccc1(c(c3(n=c1c=c2(nc6(c(=c2c)c([c-](c(c5(=nc(=cc4(nc(c=3)=c...")
(Created page with "Category:metabolite == Metabolite PYRROLINE-HYDROXY-CARBOXYLATE == * common-name: ** (3r,5s)-3-hydroxy-1-pyrroline-5-carboxylate * smiles: ** c1(=nc(c([o-])=o)cc(o)1) * in...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9098 ==
+
== Metabolite PYRROLINE-HYDROXY-CARBOXYLATE ==
 
* common-name:
 
* common-name:
** geranylgeranyl bacteriopheophytin
+
** (3r,5s)-3-hydroxy-1-pyrroline-5-carboxylate
 
* smiles:
 
* smiles:
** ccc1(c(c3(n=c1c=c2(nc6(c(=c2c)c([c-](c(c5(=nc(=cc4(nc(c=3)=c(c=4c)c(=o)c))c(c5ccc(=o)occ=c(ccc=c(ccc=c(ccc=c(c)c)c)c)c)c))=6)c(oc)=o)=o))))c)
+
** c1(=nc(c([o-])=o)cc(o)1)
 
* inchi-key:
 
* inchi-key:
** ijmymfmuuouget-riziqltbsa-n
+
** wfofkrkddkgrik-dmtcnviqsa-m
 
* molecular-weight:
 
* molecular-weight:
** 882.173
+
** 128.107
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17427]]
+
* [[RXN66-546]]
* [[RXN-8794]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=geranylgeranyl bacteriopheophytin}}
+
{{#set: common-name=(3r,5s)-3-hydroxy-1-pyrroline-5-carboxylate}}
{{#set: inchi-key=inchikey=ijmymfmuuouget-riziqltbsa-n}}
+
{{#set: inchi-key=inchikey=wfofkrkddkgrik-dmtcnviqsa-m}}
{{#set: molecular-weight=882.173}}
+
{{#set: molecular-weight=128.107}}

Revision as of 14:55, 5 January 2021

Metabolite PYRROLINE-HYDROXY-CARBOXYLATE

  • common-name:
    • (3r,5s)-3-hydroxy-1-pyrroline-5-carboxylate
  • smiles:
    • c1(=nc(c([o-])=o)cc(o)1)
  • inchi-key:
    • wfofkrkddkgrik-dmtcnviqsa-m
  • molecular-weight:
    • 128.107

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality