Difference between revisions of "CPD-9098"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-511 == * common-name: ** pantetheine * smiles: ** cc(c(o)c(=o)nccc(nccs)=o)(c)co * inchi-key: ** znxzgrmvnnhpca-vifpvbqesa-n * molecu...")
(Created page with "Category:metabolite == Metabolite CPD1G-771 == * common-name: ** 6-o-cis-methoxy-mycolyl-trehalose 6-phosphate * smiles: ** ccccccccccccccccccccccccc(c(occ1(oc(c(c(c1o)o)o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-511 ==
+
== Metabolite CPD1G-771 ==
 
* common-name:
 
* common-name:
** pantetheine
+
** 6-o-cis-methoxy-mycolyl-trehalose 6-phosphate
 
* smiles:
 
* smiles:
** cc(c(o)c(=o)nccc(nccs)=o)(c)co
+
** ccccccccccccccccccccccccc(c(occ1(oc(c(c(c1o)o)o)oc2(c(c(c(c(o2)cop([o-])(=o)[o-])o)o)o)))=o)c(o)cccccccccccccccccc3(c(ccccccccccccccccc(oc)c(c)cccccccccccccccccc)c3)
 
* inchi-key:
 
* inchi-key:
** znxzgrmvnnhpca-vifpvbqesa-n
+
** nysgjfykjqfmrn-zvnwtmltsa-l
 
* molecular-weight:
 
* molecular-weight:
** 278.366
+
** 1656.508
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PANTETHEINE-KINASE-RXN]]
+
* [[RXN1G-1436]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PANTETHEINE-KINASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=pantetheine}}
+
{{#set: common-name=6-o-cis-methoxy-mycolyl-trehalose 6-phosphate}}
{{#set: inchi-key=inchikey=znxzgrmvnnhpca-vifpvbqesa-n}}
+
{{#set: inchi-key=inchikey=nysgjfykjqfmrn-zvnwtmltsa-l}}
{{#set: molecular-weight=278.366}}
+
{{#set: molecular-weight=1656.508}}

Revision as of 13:09, 14 January 2021

Metabolite CPD1G-771

  • common-name:
    • 6-o-cis-methoxy-mycolyl-trehalose 6-phosphate
  • smiles:
    • ccccccccccccccccccccccccc(c(occ1(oc(c(c(c1o)o)o)oc2(c(c(c(c(o2)cop([o-])(=o)[o-])o)o)o)))=o)c(o)cccccccccccccccccc3(c(ccccccccccccccccc(oc)c(c)cccccccccccccccccc)c3)
  • inchi-key:
    • nysgjfykjqfmrn-zvnwtmltsa-l
  • molecular-weight:
    • 1656.508

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality