Difference between revisions of "CPD-9098"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ10361 == * transcription-direction: ** negative * right-end-position: ** 486827 * left-end-position: ** 481854 * centisome-position: ** 59.559326...")
(Created page with "Category:metabolite == Metabolite CPD-9098 == * common-name: ** geranylgeranyl bacteriopheophytin * smiles: ** ccc1(c(c3(n=c1c=c2(nc6(c(=c2c)c([c-](c(c5(=nc(=cc4(nc(c=3)=c...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ10361 ==
+
== Metabolite CPD-9098 ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** geranylgeranyl bacteriopheophytin
−
* right-end-position:
+
* smiles:
−
** 486827
+
** ccc1(c(c3(n=c1c=c2(nc6(c(=c2c)c([c-](c(c5(=nc(=cc4(nc(c=3)=c(c=4c)c(=o)c))c(c5ccc(=o)occ=c(ccc=c(ccc=c(ccc=c(c)c)c)c)c)c))=6)c(oc)=o)=o))))c)
−
* left-end-position:
+
* inchi-key:
−
** 481854
+
** ijmymfmuuouget-riziqltbsa-n
−
* centisome-position:
+
* molecular-weight:
−
** 59.559326   
+
** 882.173
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-17427]]
−
== Reaction(s) associated ==
+
* [[RXN-8794]]
−
* [[3-CH3-2-OXOBUTANOATE-OH-CH3-XFER-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=geranylgeranyl bacteriopheophytin}}
−
** Category: [[orthology]]
+
{{#set: inchi-key=inchikey=ijmymfmuuouget-riziqltbsa-n}}
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: molecular-weight=882.173}}
−
* [[KETOPANTOALDOLASE-RXN]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
* [[MOHMT]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
* [[MTMOHT]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-15635]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PANTO-PWY]]
 
−
** '''4''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-6654]]
 
−
** '''2''' reactions found over '''4''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=486827}}
 
−
{{#set: left-end-position=481854}}
 
−
{{#set: centisome-position=59.559326    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=5}}
 
−
{{#set: nb pathway associated=2}}
 

Revision as of 20:32, 18 December 2020

Metabolite CPD-9098

  • common-name:
    • geranylgeranyl bacteriopheophytin
  • smiles:
    • ccc1(c(c3(n=c1c=c2(nc6(c(=c2c)c([c-](c(c5(=nc(=cc4(nc(c=3)=c(c=4c)c(=o)c))c(c5ccc(=o)occ=c(ccc=c(ccc=c(ccc=c(c)c)c)c)c)c))=6)c(oc)=o)=o))))c)
  • inchi-key:
    • ijmymfmuuouget-riziqltbsa-n
  • molecular-weight:
    • 882.173

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-9098&oldid=46558"