Difference between revisions of "CPD-9099"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CHLOROPHYLL-B == * smiles: ** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)occ=c(c)cccc(c)cccc(c)cccc(c)c)c5(=n([mg]36(n1(=c(c(cc)=c(c=o)c1=cc=2n34)c=...") |
(Created page with "Category:metabolite == Metabolite 5-HYDROXY-FERULIC-ACID == * common-name: ** 5-hydroxyferulate * smiles: ** coc1(c=c(c=cc([o-])=o)c=c(o)c(o)=1) * inchi-key: ** yfxwtvldsk...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 5-HYDROXY-FERULIC-ACID == |
| + | * common-name: | ||
| + | ** 5-hydroxyferulate | ||
* smiles: | * smiles: | ||
| − | ** | + | ** coc1(c=c(c=cc([o-])=o)c=c(o)c(o)=1) |
| − | * | + | * inchi-key: |
| − | ** | + | ** yfxwtvldsksylw-nscuhmnnsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 209.178 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-3422]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-1121]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=5-hydroxyferulate}} |
| − | {{#set: molecular-weight= | + | {{#set: inchi-key=inchikey=yfxwtvldsksylw-nscuhmnnsa-m}} |
| + | {{#set: molecular-weight=209.178}} | ||
Revision as of 11:14, 15 January 2021
Contents
Metabolite 5-HYDROXY-FERULIC-ACID
- common-name:
- 5-hydroxyferulate
- smiles:
- coc1(c=c(c=cc([o-])=o)c=c(o)c(o)=1)
- inchi-key:
- yfxwtvldsksylw-nscuhmnnsa-m
- molecular-weight:
- 209.178
