Difference between revisions of "CPD-9099"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 5-HYDROXY-FERULIC-ACID == * common-name: ** 5-hydroxyferulate * smiles: ** coc1(c=c(c=cc([o-])=o)c=c(o)c(o)=1) * inchi-key: ** yfxwtvldsk...") |
(Created page with "Category:metabolite == Metabolite CPD-8090 == * common-name: ** 1-α-linolenoyl-2-linoleoyl-phosphatidylcholine * smiles: ** ccc=ccc=ccc=ccccccccc(occ(oc(=o)cccccccc=...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-8090 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 1-α-linolenoyl-2-linoleoyl-phosphatidylcholine |
* smiles: | * smiles: | ||
| − | ** | + | ** ccc=ccc=ccc=ccccccccc(occ(oc(=o)cccccccc=ccc=cccccc)cop([o-])(=o)occ[n+](c)(c)c)=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** qfdyidgukxrpkh-vslglsmxsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 780.076 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-8331]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-8323]] |
| + | * [[RXN-8330]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=1-α-linolenoyl-2-linoleoyl-phosphatidylcholine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=qfdyidgukxrpkh-vslglsmxsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=780.076}} |
Revision as of 08:26, 15 March 2021
Contents
Metabolite CPD-8090
- common-name:
- 1-α-linolenoyl-2-linoleoyl-phosphatidylcholine
- smiles:
- ccc=ccc=ccc=ccccccccc(occ(oc(=o)cccccccc=ccc=cccccc)cop([o-])(=o)occ[n+](c)(c)c)=o
- inchi-key:
- qfdyidgukxrpkh-vslglsmxsa-n
- molecular-weight:
- 780.076
