Difference between revisions of "CPD-9099"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ18340 == * transcription-direction: ** negative * right-end-position: ** 152919 * left-end-position: ** 132502 * centisome-position: ** 53.309357...")
 
(Created page with "Category:metabolite == Metabolite CPD-9099 == * common-name: ** dihydrogeranylgeranyl bacteriopheophytin * smiles: ** ccc5(c4(=cc6(=c(c)c1(=c(c([c-](c(=o)oc)c(=o)1)=c2(c(c...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ18340 ==
+
== Metabolite CPD-9099 ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** dihydrogeranylgeranyl bacteriopheophytin
−
* right-end-position:
+
* smiles:
−
** 152919
+
** ccc5(c4(=cc6(=c(c)c1(=c(c([c-](c(=o)oc)c(=o)1)=c2(c(ccc(occ=c(c)cccc(c)ccc=c(c)ccc=c(c)c)=o)c(c)c(=n2)c=c3(c(c)=c(c(c)=o)c(n3)=cc(=n4)c(c)5)))n6))))
−
* left-end-position:
+
* inchi-key:
−
** 132502
+
** fzuvlshmhogmop-xqjlcrkzsa-n
−
* centisome-position:
+
* molecular-weight:
−
** 53.309357   
+
** 884.189
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-8795]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[CHOLINE-KINASE-RXN]]
+
* [[RXN-8794]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=dihydrogeranylgeranyl bacteriopheophytin}}
−
** Category: [[orthology]]
+
{{#set: inchi-key=inchikey=fzuvlshmhogmop-xqjlcrkzsa-n}}
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: molecular-weight=884.189}}
−
* [[ETHANOLAMINE-KINASE-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-7782]]
 
−
** '''11''' reactions found over '''16''' reactions in the full pathway
 
−
* [[PWY3O-450]]
 
−
** '''3''' reactions found over '''3''' reactions in the full pathway
 
−
* [[PWY-7818]]
 
−
** '''2''' reactions found over '''19''' reactions in the full pathway
 
−
* [[PWY-7886]]
 
−
** '''2''' reactions found over '''3''' reactions in the full pathway
 
−
* [[PWY-3385]]
 
−
** '''2''' reactions found over '''6''' reactions in the full pathway
 
−
* [[PWY4FS-6]]
 
−
** '''3''' reactions found over '''4''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=152919}}
 
−
{{#set: left-end-position=132502}}
 
−
{{#set: centisome-position=53.309357    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=2}}
 
−
{{#set: nb pathway associated=6}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-9099

  • common-name:
    • dihydrogeranylgeranyl bacteriopheophytin
  • smiles:
    • ccc5(c4(=cc6(=c(c)c1(=c(c([c-](c(=o)oc)c(=o)1)=c2(c(ccc(occ=c(c)cccc(c)ccc=c(c)ccc=c(c)c)=o)c(c)c(=n2)c=c3(c(c)=c(c(c)=o)c(n3)=cc(=n4)c(c)5)))n6))))
  • inchi-key:
    • fzuvlshmhogmop-xqjlcrkzsa-n
  • molecular-weight:
    • 884.189

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-9099&oldid=137566"