Difference between revisions of "CPD-9099"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-18077 == * common-name: ** glc3man9glcnac2-[protein] == Reaction(s) known to consume the compound == * 3.2.1.106-RXN == Reaction(...") |
(Created page with "Category:metabolite == Metabolite CPD-9099 == * common-name: ** dihydrogeranylgeranyl bacteriopheophytin * smiles: ** ccc5(c4(=cc6(=c(c)c1(=c(c([c-](c(=o)oc)c(=o)1)=c2(c(c...") |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-9099 == |
* common-name: | * common-name: | ||
| − | ** | + | ** dihydrogeranylgeranyl bacteriopheophytin |
| + | * smiles: | ||
| + | ** ccc5(c4(=cc6(=c(c)c1(=c(c([c-](c(=o)oc)c(=o)1)=c2(c(ccc(occ=c(c)cccc(c)ccc=c(c)ccc=c(c)c)=o)c(c)c(=n2)c=c3(c(c)=c(c(c)=o)c(n3)=cc(=n4)c(c)5)))n6)))) | ||
| + | * inchi-key: | ||
| + | ** fzuvlshmhogmop-xqjlcrkzsa-n | ||
| + | * molecular-weight: | ||
| + | ** 884.189 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-8795]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-8794]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=dihydrogeranylgeranyl bacteriopheophytin}} |
| + | {{#set: inchi-key=inchikey=fzuvlshmhogmop-xqjlcrkzsa-n}} | ||
| + | {{#set: molecular-weight=884.189}} | ||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-9099
- common-name:
- dihydrogeranylgeranyl bacteriopheophytin
- smiles:
- ccc5(c4(=cc6(=c(c)c1(=c(c([c-](c(=o)oc)c(=o)1)=c2(c(ccc(occ=c(c)cccc(c)ccc=c(c)ccc=c(c)c)=o)c(c)c(=n2)c=c3(c(c)=c(c(c)=o)c(n3)=cc(=n4)c(c)5)))n6))))
- inchi-key:
- fzuvlshmhogmop-xqjlcrkzsa-n
- molecular-weight:
- 884.189
