Difference between revisions of "CPD-9099"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DUTP == * common-name: ** dutp * smiles: ** c(c2(c(cc(n1(c(nc(c=c1)=o)=o))o2)o))op(op(op(=o)([o-])[o-])([o-])=o)([o-])=o * inchi-key: **...") |
(Created page with "Category:metabolite == Metabolite PROCOLLAGEN-L-PROLINE == * common-name: ** a [procollagen]-l-proline == Reaction(s) known to consume the compound == * 1.14.11.2-RXN...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite PROCOLLAGEN-L-PROLINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** a [procollagen]-l-proline |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[1.14.11.2-RXN]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a [procollagen]-l-proline}} |
| − | |||
| − | |||
Revision as of 14:55, 5 January 2021
Contents
Metabolite PROCOLLAGEN-L-PROLINE
- common-name:
- a [procollagen]-l-proline
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [procollagen]-l-proline" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
