Difference between revisions of "CPD-9100"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite N-terminal-L-cysteine == * common-name: ** an n-terminal l-cysteinyl-[protein] == Reaction(s) known to consume the compound == == Reactio...")
(Created page with "Category:metabolite == Metabolite CPD-9100 == * common-name: ** tetrahydrogeranylgeranyl bacteriopheophytin * smiles: ** ccc5(c4(=cc6(=c(c)c1(=c(c([c-](c(=o)oc)c(=o)1)=c2(...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite N-terminal-L-cysteine ==
+
== Metabolite CPD-9100 ==
 
* common-name:
 
* common-name:
** an n-terminal l-cysteinyl-[protein]
+
** tetrahydrogeranylgeranyl bacteriopheophytin
 +
* smiles:
 +
** ccc5(c4(=cc6(=c(c)c1(=c(c([c-](c(=o)oc)c(=o)1)=c2(c(ccc(occ=c(c)cccc(c)cccc(c)ccc=c(c)c)=o)c(c)c(=n2)c=c3(c(c)=c(c(c)=o)c(n3)=cc(=n4)c(c)5)))n6))))
 +
* inchi-key:
 +
** zodfiocmoawrmb-zasykxldsa-n
 +
* molecular-weight:
 +
** 886.205
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-8796]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17874]]
+
* [[RXN-8795]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an n-terminal l-cysteinyl-[protein]}}
+
{{#set: common-name=tetrahydrogeranylgeranyl bacteriopheophytin}}
 +
{{#set: inchi-key=inchikey=zodfiocmoawrmb-zasykxldsa-n}}
 +
{{#set: molecular-weight=886.205}}

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-9100

  • common-name:
    • tetrahydrogeranylgeranyl bacteriopheophytin
  • smiles:
    • ccc5(c4(=cc6(=c(c)c1(=c(c([c-](c(=o)oc)c(=o)1)=c2(c(ccc(occ=c(c)cccc(c)cccc(c)ccc=c(c)c)=o)c(c)c(=n2)c=c3(c(c)=c(c(c)=o)c(n3)=cc(=n4)c(c)5)))n6))))
  • inchi-key:
    • zodfiocmoawrmb-zasykxldsa-n
  • molecular-weight:
    • 886.205

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality