Difference between revisions of "CPD-9100"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ21233 == * transcription-direction: ** negative * right-end-position: ** 82698 * left-end-position: ** 64403 * centisome-position: ** 32.80829...")
(Created page with "Category:metabolite == Metabolite ADENOSYL-P4 == * common-name: ** 5',5'''-diadenosine tetraphosphate * smiles: ** c(c1(c(c(c(o1)n3(c=nc2(c(=nc=nc=23)n)))o)o))op(op(op(op(...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ21233 ==
+
== Metabolite ADENOSYL-P4 ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** 5',5'''-diadenosine tetraphosphate
−
* right-end-position:
+
* smiles:
−
** 82698
+
** c(c1(c(c(c(o1)n3(c=nc2(c(=nc=nc=23)n)))o)o))op(op(op(op(occ4(c(c(c(o4)n6(c=nc5(c(=nc=nc=56)n)))o)o))([o-])=o)([o-])=o)([o-])=o)([o-])=o
−
* left-end-position:
+
* inchi-key:
−
** 64403
+
** yoahknvsncmzgq-xpwfqurosa-j
−
* centisome-position:
+
* molecular-weight:
−
** 32.80829   
+
** 832.36
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[3.6.1.41-RXN]]
−
== Reaction(s) associated ==
+
* [[ATP-ADENYLYLTRANSFERASE-RXN]]
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
== Reaction(s) known to produce the compound ==
−
* [[2-MEBUCOA-FAD-RXN]]
+
* [[ATP-ADENYLYLTRANSFERASE-RXN]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=5',5'''-diadenosine tetraphosphate}}
−
* [[ACYLCOADEHYDROG-RXN]]
+
{{#set: inchi-key=inchikey=yoahknvsncmzgq-xpwfqurosa-j}}
−
** Category: [[annotation]]
+
{{#set: molecular-weight=832.36}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[LONG-CHAIN-FATTY-ACYL-COA-REDUCTASE-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-17775]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-17779]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-17783]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-17784]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-17788]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-17792]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-17796]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
</div>
 
−
== Pathway(s) associated ==
 
−
* [[FAO-PWY]]
 
−
** '''6''' reactions found over '''7''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=82698}}
 
−
{{#set: left-end-position=64403}}
 
−
{{#set: centisome-position=32.80829    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=10}}
 
−
{{#set: nb pathway associated=1}}
 

Revision as of 20:33, 18 December 2020

Metabolite ADENOSYL-P4

  • common-name:
    • 5',5-diadenosine tetraphosphate
  • smiles:
    • c(c1(c(c(c(o1)n3(c=nc2(c(=nc=nc=23)n)))o)o))op(op(op(op(occ4(c(c(c(o4)n6(c=nc5(c(=nc=nc=56)n)))o)o))([o-])=o)([o-])=o)([o-])=o)([o-])=o
  • inchi-key:
    • yoahknvsncmzgq-xpwfqurosa-j
  • molecular-weight:
    • 832.36

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-9100&oldid=46726"