Difference between revisions of "CPD-9152"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17348 == * common-name: ** (2e, 11z,14z)-icosa-2,11,14-trienoyl-coa * smiles: ** cccccc=ccc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)...")
(Created page with "Category:metabolite == Metabolite CPD-9152 == * common-name: ** 4-chlorocatechol * smiles: ** c1(c=c(c(=cc=1cl)o)o) * inchi-key: ** wwobypkuyodhdg-uhfffaoysa-n * molecular...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17348 ==
+
== Metabolite CPD-9152 ==
 
* common-name:
 
* common-name:
** (2e, 11z,14z)-icosa-2,11,14-trienoyl-coa
+
** 4-chlorocatechol
 
* smiles:
 
* smiles:
** cccccc=ccc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c1(c=c(c(=cc=1cl)o)o)
 
* inchi-key:
 
* inchi-key:
** jlhullpftgligf-dbyuabgnsa-j
+
** wwobypkuyodhdg-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 1051.975
+
** 144.557
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16097]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16096]]
+
* [[RXN-9912]]
 +
* [[RXN-9914]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2e, 11z,14z)-icosa-2,11,14-trienoyl-coa}}
+
{{#set: common-name=4-chlorocatechol}}
{{#set: inchi-key=inchikey=jlhullpftgligf-dbyuabgnsa-j}}
+
{{#set: inchi-key=inchikey=wwobypkuyodhdg-uhfffaoysa-n}}
{{#set: molecular-weight=1051.975}}
+
{{#set: molecular-weight=144.557}}

Latest revision as of 11:18, 18 March 2021

Metabolite CPD-9152

  • common-name:
    • 4-chlorocatechol
  • smiles:
    • c1(c=c(c(=cc=1cl)o)o)
  • inchi-key:
    • wwobypkuyodhdg-uhfffaoysa-n
  • molecular-weight:
    • 144.557

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality