Difference between revisions of "CPD-9152"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15435 == * common-name: ** l-threonylcarbamoyladenylate * smiles: ** cc(o)c(c([o-])=o)nc(=o)op(occ3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))...")
(Created page with "Category:metabolite == Metabolite 2-Hydroxy-carboxylates == * common-name: ** a 2-hydroxy carboxylate == Reaction(s) known to consume the compound == == Reaction(s) known...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15435 ==
+
== Metabolite 2-Hydroxy-carboxylates ==
 
* common-name:
 
* common-name:
** l-threonylcarbamoyladenylate
+
** a 2-hydroxy carboxylate
* smiles:
 
** cc(o)c(c([o-])=o)nc(=o)op(occ3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))([o-])=o
 
* inchi-key:
 
** ghlupquheijrcu-dwvddhqfsa-l
 
* molecular-weight:
 
** 490.322
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14569]]
 
* [[RXN-14570]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14569]]
+
* [[RXN-7919]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-threonylcarbamoyladenylate}}
+
{{#set: common-name=a 2-hydroxy carboxylate}}
{{#set: inchi-key=inchikey=ghlupquheijrcu-dwvddhqfsa-l}}
 
{{#set: molecular-weight=490.322}}
 

Revision as of 15:00, 5 January 2021

Metabolite 2-Hydroxy-carboxylates

  • common-name:
    • a 2-hydroxy carboxylate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality