Difference between revisions of "CPD-9175"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 18-HYDROXYOLEATE == * common-name: ** 18-hydroxyoleate * smiles: ** c(o)cccccccc=ccccccccc(=o)[o-] * inchi-key: ** lquhzvlttwmbto-uphrsur...") |
(Created page with "Category:metabolite == Metabolite CPD-9175 == * common-name: ** n-acetyl-l-cysteine * smiles: ** cc(nc(c(=o)[o-])cs)=o * inchi-key: ** pwkskimoespyia-bypyzucnsa-m * molecu...") |
||
(One intermediate revision by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-9175 == |
* common-name: | * common-name: | ||
− | ** | + | ** n-acetyl-l-cysteine |
* smiles: | * smiles: | ||
− | ** c | + | ** cc(nc(c(=o)[o-])cs)=o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** pwkskimoespyia-bypyzucnsa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 162.183 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-13868]] |
+ | * [[RXN-15414]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=n-acetyl-l-cysteine}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=pwkskimoespyia-bypyzucnsa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=162.183}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-9175
- common-name:
- n-acetyl-l-cysteine
- smiles:
- cc(nc(c(=o)[o-])cs)=o
- inchi-key:
- pwkskimoespyia-bypyzucnsa-m
- molecular-weight:
- 162.183