Difference between revisions of "CPD-9175"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11398 == * common-name: ** l-thyroxine phenolic β-d-glucuronide * smiles: ** c(=o)([o-])c([n+])cc1(=cc(i)=c(c(i)=c1)oc3(c=c(i)c(...")
(Created page with "Category:metabolite == Metabolite CPD-9175 == * common-name: ** n-acetyl-l-cysteine * smiles: ** cc(nc(c(=o)[o-])cs)=o * inchi-key: ** pwkskimoespyia-bypyzucnsa-m * molecu...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11398 ==
+
== Metabolite CPD-9175 ==
 
* common-name:
 
* common-name:
** l-thyroxine phenolic β-d-glucuronide
+
** n-acetyl-l-cysteine
 
* smiles:
 
* smiles:
** c(=o)([o-])c([n+])cc1(=cc(i)=c(c(i)=c1)oc3(c=c(i)c(oc2(oc(c(=o)[o-])c(o)c(o)c(o)2))=c(i)c=3))
+
** cc(nc(c(=o)[o-])cs)=o
 
* inchi-key:
 
* inchi-key:
** rghrjbikiyuhev-sgpdefqssa-m
+
** pwkskimoespyia-bypyzucnsa-m
 
* molecular-weight:
 
* molecular-weight:
** 951.992
+
** 162.183
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-13868]]
 +
* [[RXN-15414]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10606]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-thyroxine phenolic β-d-glucuronide}}
+
{{#set: common-name=n-acetyl-l-cysteine}}
{{#set: inchi-key=inchikey=rghrjbikiyuhev-sgpdefqssa-m}}
+
{{#set: inchi-key=inchikey=pwkskimoespyia-bypyzucnsa-m}}
{{#set: molecular-weight=951.992}}
+
{{#set: molecular-weight=162.183}}

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-9175

  • common-name:
    • n-acetyl-l-cysteine
  • smiles:
    • cc(nc(c(=o)[o-])cs)=o
  • inchi-key:
    • pwkskimoespyia-bypyzucnsa-m
  • molecular-weight:
    • 162.183

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality