Difference between revisions of "CPD-9245"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ09717 == * transcription-direction: ** positive * right-end-position: ** 41300 * left-end-position: ** 25956 * centisome-position: ** 3.1937826...") |
(Created page with "Category:metabolite == Metabolite CPD-9245 == * common-name: ** palmitoleate * smiles: ** ccccccc=ccccccccc(=o)[o-] * inchi-key: ** secpzkhbenqxjg-fplpwbnlsa-m * molecular...") |
||
| (7 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-9245 == |
| − | * | + | * common-name: |
| − | ** | + | ** palmitoleate |
| − | * | + | * smiles: |
| − | ** | + | ** ccccccc=ccccccccc(=o)[o-] |
| − | * | + | * inchi-key: |
| − | ** | + | ** secpzkhbenqxjg-fplpwbnlsa-m |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 253.404 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN0-7248]] |
| − | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
| − | * [[ | + | * [[RXN-10662]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=palmitoleate}} | |
| − | + | {{#set: inchi-key=inchikey=secpzkhbenqxjg-fplpwbnlsa-m}} | |
| − | + | {{#set: molecular-weight=253.404}} | |
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-9245
- common-name:
- palmitoleate
- smiles:
- ccccccc=ccccccccc(=o)[o-]
- inchi-key:
- secpzkhbenqxjg-fplpwbnlsa-m
- molecular-weight:
- 253.404
