Difference between revisions of "CPD-9245"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Oxidized-cytochromes-c551 == * common-name: ** an oxidized cytochrome c551 == Reaction(s) known to consume the compound == * [[RXN-15838]...")
(Created page with "Category:metabolite == Metabolite CPD-9245 == * common-name: ** palmitoleate * smiles: ** ccccccc=ccccccccc(=o)[o-] * inchi-key: ** secpzkhbenqxjg-fplpwbnlsa-m * molecular...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Oxidized-cytochromes-c551 ==
+
== Metabolite CPD-9245 ==
 
* common-name:
 
* common-name:
** an oxidized cytochrome c551
+
** palmitoleate
 +
* smiles:
 +
** ccccccc=ccccccccc(=o)[o-]
 +
* inchi-key:
 +
** secpzkhbenqxjg-fplpwbnlsa-m
 +
* molecular-weight:
 +
** 253.404
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15838]]
+
* [[RXN0-7248]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15838]]
+
* [[RXN-10662]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an oxidized cytochrome c551}}
+
{{#set: common-name=palmitoleate}}
 +
{{#set: inchi-key=inchikey=secpzkhbenqxjg-fplpwbnlsa-m}}
 +
{{#set: molecular-weight=253.404}}

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-9245

  • common-name:
    • palmitoleate
  • smiles:
    • ccccccc=ccccccccc(=o)[o-]
  • inchi-key:
    • secpzkhbenqxjg-fplpwbnlsa-m
  • molecular-weight:
    • 253.404

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality