Difference between revisions of "CPD-9406"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8087 == * common-name: ** 1-α-linolenoyl-2-palmitoyl-phosphatidylglycerol * smiles: ** ccc=ccc=ccc=ccccccccc(=o)occ(oc(=o)ccccc...")
(Created page with "Category:metabolite == Metabolite CPD-9406 == * common-name: ** (2s)-ethylmalonyl-coa * smiles: ** ccc(c(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-]...")
 
(5 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8087 ==
+
== Metabolite CPD-9406 ==
 
* common-name:
 
* common-name:
** 1-α-linolenoyl-2-palmitoyl-phosphatidylglycerol
+
** (2s)-ethylmalonyl-coa
 
* smiles:
 
* smiles:
** ccc=ccc=ccc=ccccccccc(=o)occ(oc(=o)ccccccccccccccc)cop(=o)([o-])occ(co)o
+
** ccc(c(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)c([o-])=o
 
* inchi-key:
 
* inchi-key:
** lzcstajdqulbas-ftznwaqrsa-m
+
** vugzqvcbbbezqe-uqcjfraesa-i
 
* molecular-weight:
 
* molecular-weight:
** 743.977
+
** 876.595
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8319]]
+
* [[RXN-13029]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8317]]
+
* [[RXN-13029]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-α-linolenoyl-2-palmitoyl-phosphatidylglycerol}}
+
{{#set: common-name=(2s)-ethylmalonyl-coa}}
{{#set: inchi-key=inchikey=lzcstajdqulbas-ftznwaqrsa-m}}
+
{{#set: inchi-key=inchikey=vugzqvcbbbezqe-uqcjfraesa-i}}
{{#set: molecular-weight=743.977}}
+
{{#set: molecular-weight=876.595}}

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-9406

  • common-name:
    • (2s)-ethylmalonyl-coa
  • smiles:
    • ccc(c(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)c([o-])=o
  • inchi-key:
    • vugzqvcbbbezqe-uqcjfraesa-i
  • molecular-weight:
    • 876.595

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality