Difference between revisions of "CPD-9406"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-5286 RXN-5286] == * direction: ** left-to-right * common-name: ** 3,8-divinyl-chlorophyllide 8-...")
(Created page with "Category:metabolite == Metabolite CPD-15362 == * common-name: ** (2e,11z)-icosa-2,11-dienoyl-coa * smiles: ** ccccccccc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)...")
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-5286 RXN-5286] ==
+
== Metabolite CPD-15362 ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** 3,8-divinyl-chlorophyllide 8-vinyl reductase
+
** (2e,11z)-icosa-2,11-dienoyl-coa
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/1.3.1.75 ec-1.3.1.75]
+
** ccccccccc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
== Reaction formula ==
+
* inchi-key:
* 1 [[DIVINYLCHLOROPHYLLIDE-A]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CHLOROPHYLLIDE-A]][c] '''+''' 1 [[NADP]][c]
+
** laeceuxzoonxdy-nwgwhigpsa-j
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ12431]]
+
** 1053.99
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) known to produce the compound ==
** Category: [[orthology]]
+
* [[RXN-14485]]
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) of unknown directionality ==
== Pathway(s) ==
+
{{#set: common-name=(2e,11z)-icosa-2,11-dienoyl-coa}}
* [[PWY-5086]], chlorophyll a biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5086 PWY-5086]
+
{{#set: inchi-key=inchikey=laeceuxzoonxdy-nwgwhigpsa-j}}
** '''2''' reactions found over '''2''' reactions in the full pathway
+
{{#set: molecular-weight=1053.99}}
* [[PWY-7760]], bacteriochlorophyll e biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7760 PWY-7760]
 
** '''1''' reactions found over '''30''' reactions in the full pathway
 
* [[PWY-7758]], bacteriochlorophyll d biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7758 PWY-7758]
 
** '''1''' reactions found over '''14''' reactions in the full pathway
 
* [[PWY-7759]], bacteriochlorophyll c biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7759 PWY-7759]
 
** '''1''' reactions found over '''18''' reactions in the full pathway
 
* [[PWY-5064]], chlorophyll a biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5064 PWY-5064]
 
** '''5''' reactions found over '''5''' reactions in the full pathway
 
* [[PWY-5526]], bacteriochlorophyll a biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5526 PWY-5526]
 
** '''5''' reactions found over '''13''' reactions in the full pathway
 
== Reconstruction information  ==
 
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
== External links  ==
 
* RHEA:
 
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=14451 14451]
 
* LIGAND-RXN:
 
** [http://www.genome.jp/dbget-bin/www_bget?R06272 R06272]
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=3,8-divinyl-chlorophyllide 8-vinyl reductase}}
 
{{#set: ec-number=ec-1.3.1.75}}
 
{{#set: nb gene associated=1}}
 
{{#set: nb pathway associated=6}}
 
{{#set: reconstruction category=annotation|orthology}}
 
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=output_pantograph_nannochloropsis_salina|saccharina_japonica_genome}}
 

Revision as of 20:38, 18 December 2020

Metabolite CPD-15362

  • common-name:
    • (2e,11z)-icosa-2,11-dienoyl-coa
  • smiles:
    • ccccccccc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • laeceuxzoonxdy-nwgwhigpsa-j
  • molecular-weight:
    • 1053.99

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality