Difference between revisions of "CPD-9406"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15362 == * common-name: ** (2e,11z)-icosa-2,11-dienoyl-coa * smiles: ** ccccccccc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)...")
(Created page with "Category:metabolite == Metabolite CPD-8087 == * common-name: ** 1-α-linolenoyl-2-palmitoyl-phosphatidylglycerol * smiles: ** ccc=ccc=ccc=ccccccccc(=o)occ(oc(=o)ccccc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15362 ==
+
== Metabolite CPD-8087 ==
 
* common-name:
 
* common-name:
** (2e,11z)-icosa-2,11-dienoyl-coa
+
** 1-α-linolenoyl-2-palmitoyl-phosphatidylglycerol
 
* smiles:
 
* smiles:
** ccccccccc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** ccc=ccc=ccc=ccccccccc(=o)occ(oc(=o)ccccccccccccccc)cop(=o)([o-])occ(co)o
 
* inchi-key:
 
* inchi-key:
** laeceuxzoonxdy-nwgwhigpsa-j
+
** lzcstajdqulbas-ftznwaqrsa-m
 
* molecular-weight:
 
* molecular-weight:
** 1053.99
+
** 743.977
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-8319]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14485]]
+
* [[RXN-8317]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2e,11z)-icosa-2,11-dienoyl-coa}}
+
{{#set: common-name=1-α-linolenoyl-2-palmitoyl-phosphatidylglycerol}}
{{#set: inchi-key=inchikey=laeceuxzoonxdy-nwgwhigpsa-j}}
+
{{#set: inchi-key=inchikey=lzcstajdqulbas-ftznwaqrsa-m}}
{{#set: molecular-weight=1053.99}}
+
{{#set: molecular-weight=743.977}}

Revision as of 15:00, 5 January 2021

Metabolite CPD-8087

  • common-name:
    • 1-α-linolenoyl-2-palmitoyl-phosphatidylglycerol
  • smiles:
    • ccc=ccc=ccc=ccccccccc(=o)occ(oc(=o)ccccccccccccccc)cop(=o)([o-])occ(co)o
  • inchi-key:
    • lzcstajdqulbas-ftznwaqrsa-m
  • molecular-weight:
    • 743.977

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality