Difference between revisions of "CPD-9446"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ12700 == * transcription-direction: ** positive * right-end-position: ** 349973 * left-end-position: ** 345234 * centisome-position: ** 97.067184...")
(Created page with "Category:metabolite == Metabolite DEOXYXYLULOSE-5P == * common-name: ** 1-deoxy-d-xylulose 5-phosphate * smiles: ** cc(=o)c(o)c(o)cop([o-])(=o)[o-] * inchi-key: ** ajpadpz...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ12700 ==
+
== Metabolite DEOXYXYLULOSE-5P ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** 1-deoxy-d-xylulose 5-phosphate
−
* right-end-position:
+
* smiles:
−
** 349973
+
** cc(=o)c(o)c(o)cop([o-])(=o)[o-]
−
* left-end-position:
+
* inchi-key:
−
** 345234
+
** ajpadpzsrrughi-rfzpgflssa-l
−
* centisome-position:
+
* molecular-weight:
−
** 97.067184   
+
** 212.096
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[DXPREDISOM-RXN]]
−
== Reaction(s) associated ==
+
* [[THIAZOLSYN2-RXN]]
−
* [[GLUTAMATE-SYNTHASE-FERREDOXIN-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
* [[DXPREDISOM-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[DXS-RXN]]
−
* [[GLUTAMIN-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=1-deoxy-d-xylulose 5-phosphate}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=ajpadpzsrrughi-rfzpgflssa-l}}
−
* [[RXN-12878]]
+
{{#set: molecular-weight=212.096}}
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-6549]]
 
−
** '''8''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-4341]]
 
−
** '''1''' reactions found over '''1''' reactions in the full pathway
 
−
* [[PWY-6964]]
 
−
** '''2''' reactions found over '''2''' reactions in the full pathway
 
−
* [[CITRULBIO-PWY]]
 
−
** '''7''' reactions found over '''8''' reactions in the full pathway
 
−
* [[GLUTAMINDEG-PWY]]
 
−
** '''1''' reactions found over '''1''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=349973}}
 
−
{{#set: left-end-position=345234}}
 
−
{{#set: centisome-position=97.067184    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=3}}
 
−
{{#set: nb pathway associated=5}}
 

Revision as of 20:32, 18 December 2020

Metabolite DEOXYXYLULOSE-5P

  • common-name:
    • 1-deoxy-d-xylulose 5-phosphate
  • smiles:
    • cc(=o)c(o)c(o)cop([o-])(=o)[o-]
  • inchi-key:
    • ajpadpzsrrughi-rfzpgflssa-l
  • molecular-weight:
    • 212.096

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-9446&oldid=46353"