Difference between revisions of "CPD-9446"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8090 == * common-name: ** 1-α-linolenoyl-2-linoleoyl-phosphatidylcholine * smiles: ** ccc=ccc=ccc=ccccccccc(occ(oc(=o)cccccccc=...") |
(Created page with "Category:metabolite == Metabolite RIBOSE-1-ARSENATE == * common-name: ** ribose-1-arsenate * smiles: ** c(o)c1(c(o)c(o)c(o[as]([o-])(=o)[o-])o1) * inchi-key: ** ryjjomqpaa...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite RIBOSE-1-ARSENATE == |
* common-name: | * common-name: | ||
| − | ** 1- | + | ** ribose-1-arsenate |
* smiles: | * smiles: | ||
| − | ** | + | ** c(o)c1(c(o)c(o)c(o[as]([o-])(=o)[o-])o1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ryjjomqpaaufbf-txicztdvsa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 272.043 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-7001]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=1- | + | {{#set: common-name=ribose-1-arsenate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ryjjomqpaaufbf-txicztdvsa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=272.043}} |
Revision as of 15:26, 5 January 2021
Contents
Metabolite RIBOSE-1-ARSENATE
- common-name:
- ribose-1-arsenate
- smiles:
- c(o)c1(c(o)c(o)c(o[as]([o-])(=o)[o-])o1)
- inchi-key:
- ryjjomqpaaufbf-txicztdvsa-l
- molecular-weight:
- 272.043
