Difference between revisions of "CPD-9459"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12242 RXN-12242] == * direction: ** left-to-right * common-name: ** 9,9'-di-cis-ζ-carotene...")
(Created page with "Category:metabolite == Metabolite CPD-12321 == * common-name: ** 15-cis-phytoene * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cc=cc=c(ccc=c(ccc=c(ccc=c(c)c)c)c)c * inchi-key...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12242 RXN-12242] ==
+
== Metabolite CPD-12321 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** 9,9'-di-cis-ζ-carotene desaturase
+
** 15-cis-phytoene
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.3.5.6 ec-1.3.5.6]
+
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cc=cc=c(ccc=c(ccc=c(ccc=c(c)c)c)c)c
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CPD-7526]][c] '''+''' 2 [[ETR-Quinones]][c] '''=>''' 1 [[CPD-7496]][c] '''+''' 2 [[ETR-Quinols]][c]
+
** yvlpjigomtxxlp-bhljudrvsa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ05680]]
+
** 544.946
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-11355]]
−
** Category: [[orthology]]
+
* [[RXN-12243]]
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[RXN-12413]]
−
* Gene: [[SJ05681]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
* [[RXN-13323]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXNARA-8002]]
−
== Pathway(s) ==
+
== Reaction(s) of unknown directionality ==
−
== Reconstruction information  ==
+
{{#set: common-name=15-cis-phytoene}}
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=yvlpjigomtxxlp-bhljudrvsa-n}}
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: molecular-weight=544.946}}
−
== External links  ==
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=9,9'-di-cis-ζ-carotene desaturase}}
 
−
{{#set: ec-number=ec-1.3.5.6}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=annotation|orthology}}
 
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Revision as of 20:37, 18 December 2020

Metabolite CPD-12321

  • common-name:
    • 15-cis-phytoene
  • smiles:
    • cc(c)=cccc(c)=cccc(c)=cccc(c)=cc=cc=c(ccc=c(ccc=c(ccc=c(c)c)c)c)c
  • inchi-key:
    • yvlpjigomtxxlp-bhljudrvsa-n
  • molecular-weight:
    • 544.946

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-9459&oldid=48371"