Difference between revisions of "CPD-9612"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DNA-Ligase-L-lysine-guanylate == * common-name: ** a [dna ligase]-l-lysine-guanylate == Reaction(s) known to consume the compound == * ...") |
(Created page with "Category:metabolite == Metabolite CPD-9612 == * common-name: ** caldariellaquinone * smiles: ** cc(c)cccc(c)cccc(c)cccc(c)cccc(c)cccc(c)ccc2(=c(sc)c(=o)c1(=c(sc=c1)c(=o)2)...") |
||
| (2 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-9612 == |
* common-name: | * common-name: | ||
| − | ** | + | ** caldariellaquinone |
| + | * smiles: | ||
| + | ** cc(c)cccc(c)cccc(c)cccc(c)cccc(c)cccc(c)ccc2(=c(sc)c(=o)c1(=c(sc=c1)c(=o)2)) | ||
| + | * inchi-key: | ||
| + | ** ghrwxpxobgrshg-uhfffaoysa-n | ||
| + | * molecular-weight: | ||
| + | ** 631.069 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-15378]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=caldariellaquinone}} |
| + | {{#set: inchi-key=inchikey=ghrwxpxobgrshg-uhfffaoysa-n}} | ||
| + | {{#set: molecular-weight=631.069}} | ||
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-9612
- common-name:
- caldariellaquinone
- smiles:
- cc(c)cccc(c)cccc(c)cccc(c)cccc(c)cccc(c)ccc2(=c(sc)c(=o)c1(=c(sc=c1)c(=o)2))
- inchi-key:
- ghrwxpxobgrshg-uhfffaoysa-n
- molecular-weight:
- 631.069
