Difference between revisions of "CPD-9612"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-5165 == * common-name: ** α-d-man-(1→2)-α-d-man-(1→2)-α-d-man-(1→3)-[α-d-man-(1→3)-&alpha...")
(Created page with "Category:metabolite == Metabolite CPD-9612 == * common-name: ** caldariellaquinone * smiles: ** cc(c)cccc(c)cccc(c)cccc(c)cccc(c)cccc(c)ccc2(=c(sc)c(=o)c1(=c(sc=c1)c(=o)2)...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-5165 ==
+
== Metabolite CPD-9612 ==
 
* common-name:
 
* common-name:
** α-d-man-(1→2)-α-d-man-(1→2)-α-d-man-(1→3)-[α-d-man-(1→3)-α-d-man-(1→6)]-β-d-man-(1→4)-β-d-glcnac-(1→4)-α-d-glcnac-diphosphodolichol
+
** caldariellaquinone
 +
* smiles:
 +
** cc(c)cccc(c)cccc(c)cccc(c)cccc(c)cccc(c)ccc2(=c(sc)c(=o)c1(=c(sc=c1)c(=o)2))
 +
* inchi-key:
 +
** ghrwxpxobgrshg-uhfffaoysa-n
 +
* molecular-weight:
 +
** 631.069
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-5467]]
+
* [[RXN-15378]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-5466]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=α-d-man-(1→2)-α-d-man-(1→2)-α-d-man-(1→3)-[α-d-man-(1→3)-α-d-man-(1→6)]-β-d-man-(1→4)-β-d-glcnac-(1→4)-α-d-glcnac-diphosphodolichol}}
+
{{#set: common-name=caldariellaquinone}}
 +
{{#set: inchi-key=inchikey=ghrwxpxobgrshg-uhfffaoysa-n}}
 +
{{#set: molecular-weight=631.069}}

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-9612

  • common-name:
    • caldariellaquinone
  • smiles:
    • cc(c)cccc(c)cccc(c)cccc(c)cccc(c)cccc(c)ccc2(=c(sc)c(=o)c1(=c(sc=c1)c(=o)2))
  • inchi-key:
    • ghrwxpxobgrshg-uhfffaoysa-n
  • molecular-weight:
    • 631.069

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality