Difference between revisions of "CPD-9612"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.7.1.160-RXN 2.7.1.160-RXN] == * direction: ** left-to-right * common-name: ** trna 2'-phosphotran...")
(Created page with "Category:metabolite == Metabolite CPD-9612 == * common-name: ** caldariellaquinone * smiles: ** cc(c)cccc(c)cccc(c)cccc(c)cccc(c)cccc(c)ccc2(=c(sc)c(=o)c1(=c(sc=c1)c(=o)2)...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.7.1.160-RXN 2.7.1.160-RXN] ==
+
== Metabolite CPD-9612 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** trna 2'-phosphotransferase
+
** caldariellaquinone
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.7.1.160 ec-2.7.1.160]
+
** cc(c)cccc(c)cccc(c)cccc(c)cccc(c)cccc(c)ccc2(=c(sc)c(=o)c1(=c(sc=c1)c(=o)2))
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[2-phospho-ligated-tRNA]][c] '''+''' 1 [[NAD]][c] '''=>''' 1 [[CPD-9007]][c] '''+''' 1 [[NIACINAMIDE]][c] '''+''' 1 [[Spliced-tRNA-precursor]][c]
+
** ghrwxpxobgrshg-uhfffaoysa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ14983]]
+
** 631.069
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-15378]]
−
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
−
* [[PWY-6689]], tRNA splicing I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6689 PWY-6689]
+
== Reaction(s) of unknown directionality ==
−
** '''2''' reactions found over '''7''' reactions in the full pathway
+
{{#set: common-name=caldariellaquinone}}
−
== Reconstruction information  ==
+
{{#set: inchi-key=inchikey=ghrwxpxobgrshg-uhfffaoysa-n}}
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=631.069}}
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=23325 23325]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=trna 2'-phosphotransferase}}
 
−
{{#set: ec-number=ec-2.7.1.160}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-9612

  • common-name:
    • caldariellaquinone
  • smiles:
    • cc(c)cccc(c)cccc(c)cccc(c)cccc(c)cccc(c)ccc2(=c(sc)c(=o)c1(=c(sc=c1)c(=o)2))
  • inchi-key:
    • ghrwxpxobgrshg-uhfffaoysa-n
  • molecular-weight:
    • 631.069

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-9612&oldid=139213"