Difference between revisions of "CPD-9646"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ACP == * common-name: ** a holo-[acyl-carrier protein] == Reaction(s) known to consume the compound == * 2.3.1.41-RXN * 3.1.4.14-RX...")
(Created page with "Category:metabolite == Metabolite CPD-7137 == * common-name: ** pelargonidin-3,5-di-o-β-d-glucoside * smiles: ** c(o)c5(c(c(c(c(oc3(=cc([o-])=cc2([o+]=c(c1(=cc=c(o)c=...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ACP ==
+
== Metabolite CPD-7137 ==
 
* common-name:
 
* common-name:
** a holo-[acyl-carrier protein]
+
** pelargonidin-3,5-di-o-β-d-glucoside
 +
* smiles:
 +
** c(o)c5(c(c(c(c(oc3(=cc([o-])=cc2([o+]=c(c1(=cc=c(o)c=c1))c(=cc=23)oc4(c(o)c(o)c(o)c(co)o4))))o5)o)o)o)
 +
* inchi-key:
 +
** slckjkwfulxzbd-zotffytfsa-n
 +
* molecular-weight:
 +
** 594.525
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.3.1.41-RXN]]
 
* [[3.1.4.14-RXN]]
 
* [[ACP-S-ACETYLTRANSFER-RXN]]
 
* [[MALONYL-COA-ACP-TRANSACYL-RXN]]
 
* [[RXN-17155]]
 
* [[RXN3O-8214]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[RXN-7828]]
* [[1-ACYLGLYCEROL-3-P-ACYLTRANSFER-RXN]]
 
* [[2.3.1.179-RXN]]
 
* [[2.3.1.41-RXN]]
 
* [[3-OXOACYL-ACP-SYNTH-BASE-RXN]]
 
* [[3-OXOACYL-ACP-SYNTH-RXN]]
 
* [[3.1.2.21-RXN]]
 
* [[ACP-S-ACETYLTRANSFER-RXN]]
 
* [[HOLO-ACP-SYNTH-RXN]]
 
* [[RXN-10462]]
 
* [[RXN-10654]]
 
* [[RXN-10658]]
 
* [[RXN-10727]]
 
* [[RXN-11474]]
 
* [[RXN-11479]]
 
* [[RXN-11797]]
 
* [[RXN-13037]]
 
* [[RXN-16024]]
 
* [[RXN-16025]]
 
* [[RXN-16067]]
 
* [[RXN-16076]]
 
* [[RXN-16077]]
 
* [[RXN-16615]]
 
* [[RXN-16621]]
 
* [[RXN-16625]]
 
* [[RXN-16629]]
 
* [[RXN-17012]]
 
* [[RXN-17013]]
 
* [[RXN-17014]]
 
* [[RXN-17015]]
 
* [[RXN-17016]]
 
* [[RXN-17017]]
 
* [[RXN-17018]]
 
* [[RXN-17020]]
 
* [[RXN-17022]]
 
* [[RXN-17024]]
 
* [[RXN-8391]]
 
* [[RXN-9516]]
 
* [[RXN-9523]]
 
* [[RXN-9527]]
 
* [[RXN-9531]]
 
* [[RXN-9535]]
 
* [[RXN-9539]]
 
* [[RXN-9548]]
 
* [[RXN-9549]]
 
* [[RXN0-2141]]
 
* [[RXN0-5514]]
 
* [[RXN0-6705]]
 
* [[RXN0-947]]
 
* [[RXN3O-1803]]
 
* [[RXN3O-5304]]
 
* [[RXN3O-8214]]
 
* [[RXN3O-9780]]
 
* [[UDPHYDROXYMYRGLUCOSAMNACETYLTRANS-RXN]]
 
</div>
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a holo-[acyl-carrier protein]}}
+
{{#set: common-name=pelargonidin-3,5-di-o-&beta;-d-glucoside}}
 +
{{#set: inchi-key=inchikey=slckjkwfulxzbd-zotffytfsa-n}}
 +
{{#set: molecular-weight=594.525}}

Revision as of 08:26, 15 March 2021

Metabolite CPD-7137

  • common-name:
    • pelargonidin-3,5-di-o-β-d-glucoside
  • smiles:
    • c(o)c5(c(c(c(c(oc3(=cc([o-])=cc2([o+]=c(c1(=cc=c(o)c=c1))c(=cc=23)oc4(c(o)c(o)c(o)c(co)o4))))o5)o)o)o)
  • inchi-key:
    • slckjkwfulxzbd-zotffytfsa-n
  • molecular-weight:
    • 594.525

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality