Difference between revisions of "CPD-9646"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite UDP-SULFOQUINOVOSE == * common-name: ** udp-α-d-sulfoquinovopyranose * smiles: ** c(op(=o)([o-])op(=o)(oc1(oc(cs(=o)(=o)[o-])c(o)c(...")
(Created page with "Category:metabolite == Metabolite CPD-9646 == * common-name: ** di-trans,octa-cis-undecaprenyl phosphate * smiles: ** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(...")
 
(4 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite UDP-SULFOQUINOVOSE ==
+
== Metabolite CPD-9646 ==
 
* common-name:
 
* common-name:
** udp-α-d-sulfoquinovopyranose
+
** di-trans,octa-cis-undecaprenyl phosphate
 
* smiles:
 
* smiles:
** c(op(=o)([o-])op(=o)(oc1(oc(cs(=o)(=o)[o-])c(o)c(o)c(o)1))[o-])c2(c(o)c(o)c(o2)n3(c=cc(=o)nc(=o)3))
+
** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])[o-])c)c)c
 
* inchi-key:
 
* inchi-key:
** fqancgqcbcusmi-jzmiexbbsa-k
+
** ufphfkctoziafy-ntdveaecsa-l
 
* molecular-weight:
 
* molecular-weight:
** 627.34
+
** 845.279
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[PHOSNACMURPENTATRANS-RXN]]
 +
* [[RXN-11347]]
 +
* [[RXN-8975]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-1223]]
+
* [[RXN-8975]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=udp-α-d-sulfoquinovopyranose}}
+
{{#set: common-name=di-trans,octa-cis-undecaprenyl phosphate}}
{{#set: inchi-key=inchikey=fqancgqcbcusmi-jzmiexbbsa-k}}
+
{{#set: inchi-key=inchikey=ufphfkctoziafy-ntdveaecsa-l}}
{{#set: molecular-weight=627.34}}
+
{{#set: molecular-weight=845.279}}

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-9646

  • common-name:
    • di-trans,octa-cis-undecaprenyl phosphate
  • smiles:
    • cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])[o-])c)c)c
  • inchi-key:
    • ufphfkctoziafy-ntdveaecsa-l
  • molecular-weight:
    • 845.279

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality