Difference between revisions of "CPD-9646"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite UDP-SULFOQUINOVOSE == * common-name: ** udp-α-d-sulfoquinovopyranose * smiles: ** c(op(=o)([o-])op(=o)(oc1(oc(cs(=o)(=o)[o-])c(o)c(...") |
(Created page with "Category:metabolite == Metabolite CPD-9646 == * common-name: ** di-trans,octa-cis-undecaprenyl phosphate * smiles: ** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(...") |
||
(4 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-9646 == |
* common-name: | * common-name: | ||
− | ** | + | ** di-trans,octa-cis-undecaprenyl phosphate |
* smiles: | * smiles: | ||
− | ** | + | ** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])[o-])c)c)c |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** ufphfkctoziafy-ntdveaecsa-l |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 845.279 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[PHOSNACMURPENTATRANS-RXN]] | ||
+ | * [[RXN-11347]] | ||
+ | * [[RXN-8975]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-8975]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=di-trans,octa-cis-undecaprenyl phosphate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ufphfkctoziafy-ntdveaecsa-l}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=845.279}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-9646
- common-name:
- di-trans,octa-cis-undecaprenyl phosphate
- smiles:
- cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])[o-])c)c)c
- inchi-key:
- ufphfkctoziafy-ntdveaecsa-l
- molecular-weight:
- 845.279