Difference between revisions of "CPD-9699"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13187 == * common-name: ** unsaturated gellan tetrasaccharide * smiles: ** cc2(oc(oc1(c(o)c(o)oc(co)c(o)1))c(o)c(o)c2oc3(oc(co)c(c(o)...") |
(Created page with "Category:metabolite == Metabolite CPD-9699 == * common-name: ** hypoglycin a * smiles: ** c=c1(c(cc([n+])c([o-])=o)c1) * inchi-key: ** oojzcxfxpzgubj-uhfffaoysa-n * molecu...") |
||
| (5 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-9699 == |
* common-name: | * common-name: | ||
| − | ** | + | ** hypoglycin a |
* smiles: | * smiles: | ||
| − | ** | + | ** c=c1(c(cc([n+])c([o-])=o)c1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** oojzcxfxpzgubj-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 141.169 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-9157]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=hypoglycin a}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=oojzcxfxpzgubj-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=141.169}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-9699
- common-name:
- hypoglycin a
- smiles:
- c=c1(c(cc([n+])c([o-])=o)c1)
- inchi-key:
- oojzcxfxpzgubj-uhfffaoysa-n
- molecular-weight:
- 141.169
