Difference between revisions of "CPD-9700"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-187 == * common-name: ** 4-hydroxy-4-methyl-2-oxoglutarate == Reaction(s) known to consume the compound == == Reaction(s) known to pr...") |
(Created page with "Category:metabolite == Metabolite CPD-9700 == * common-name: ** hypoglycin b * smiles: ** c=c1(c(cc(c(=o)[o-])nc(ccc([n+])c([o-])=o)=o)c1) * inchi-key: ** uydzycpiqsrxku-n...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-9700 == |
* common-name: | * common-name: | ||
− | ** | + | ** hypoglycin b |
+ | * smiles: | ||
+ | ** c=c1(c(cc(c(=o)[o-])nc(ccc([n+])c([o-])=o)=o)c1) | ||
+ | * inchi-key: | ||
+ | ** uydzycpiqsrxku-nppuscpjsa-m | ||
+ | * molecular-weight: | ||
+ | ** 269.277 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-9157]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=hypoglycin b}} |
+ | {{#set: inchi-key=inchikey=uydzycpiqsrxku-nppuscpjsa-m}} | ||
+ | {{#set: molecular-weight=269.277}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD-9700
- common-name:
- hypoglycin b
- smiles:
- c=c1(c(cc(c(=o)[o-])nc(ccc([n+])c([o-])=o)=o)c1)
- inchi-key:
- uydzycpiqsrxku-nppuscpjsa-m
- molecular-weight:
- 269.277