Difference between revisions of "CPD-9700"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DNA-with-Uracils == * common-name: ** a uracil in dna == Reaction(s) known to consume the compound == * RXN0-2584 == Reaction(s) know...")
(Created page with "Category:metabolite == Metabolite CPD-9700 == * common-name: ** hypoglycin b * smiles: ** c=c1(c(cc(c(=o)[o-])nc(ccc([n+])c([o-])=o)=o)c1) * inchi-key: ** uydzycpiqsrxku-n...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DNA-with-Uracils ==
+
== Metabolite CPD-9700 ==
 
* common-name:
 
* common-name:
** a uracil in dna
+
** hypoglycin b
 +
* smiles:
 +
** c=c1(c(cc(c(=o)[o-])nc(ccc([n+])c([o-])=o)=o)c1)
 +
* inchi-key:
 +
** uydzycpiqsrxku-nppuscpjsa-m
 +
* molecular-weight:
 +
** 269.277
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-2584]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-9157]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a uracil in dna}}
+
{{#set: common-name=hypoglycin b}}
 +
{{#set: inchi-key=inchikey=uydzycpiqsrxku-nppuscpjsa-m}}
 +
{{#set: molecular-weight=269.277}}

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-9700

  • common-name:
    • hypoglycin b
  • smiles:
    • c=c1(c(cc(c(=o)[o-])nc(ccc([n+])c([o-])=o)=o)c1)
  • inchi-key:
    • uydzycpiqsrxku-nppuscpjsa-m
  • molecular-weight:
    • 269.277

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality