|
|
| (7 intermediate revisions by 3 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=AMINOCYL-TRNA-HYDROLASE-RXN AMINOCYL-TRNA-HYDROLASE-RXN] == | + | == Metabolite CPD-9700 == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** peptidyl-trna hydrolase | + | ** hypoglycin b |
| − | ** aminoacyl-trna hydrolase
| + | * smiles: |
| − | * ec-number: | + | ** c=c1(c(cc(c(=o)[o-])nc(ccc([n+])c([o-])=o)=o)c1) |
| − | ** [http://enzyme.expasy.org/EC/3.1.1.29 ec-3.1.1.29] | + | * inchi-key: |
| − | == Reaction formula == | + | ** uydzycpiqsrxku-nppuscpjsa-m |
| − | * 1 [[N-Substituted-Aminoacyl-tRNA]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[N-Substituted-Amino-Acids]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[tRNAs]][c]
| + | * molecular-weight: |
| − | == Gene(s) associated with this reaction == | + | ** 269.277 |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| + | == Reaction(s) known to consume the compound == |
| − | * Gene: [[SJ05960]] | + | == Reaction(s) known to produce the compound == |
| − | ** Category: [[annotation]]
| + | * [[RXN-9157]] |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| + | == Reaction(s) of unknown directionality == |
| − | * Gene: [[SJ02121]]
| + | {{#set: common-name=hypoglycin b}} |
| − | ** Category: [[annotation]]
| + | {{#set: inchi-key=inchikey=uydzycpiqsrxku-nppuscpjsa-m}} |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | + | {{#set: molecular-weight=269.277}} |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | * Gene: [[SJ03879]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | ** Category: [[orthology]] | |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | * Gene: [[SJ09079]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | * Gene: [[SJ00680]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | |
| − | </div>
| |
| − | == Pathway(s) == | |
| − | == Reconstruction information == | |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a | |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | == External links == | |
| − | * UNIPROT:
| |
| − | ** [http://www.uniprot.org/uniprot/Q9JV42 Q9JV42]
| |
| − | ** [http://www.uniprot.org/uniprot/P44682 P44682]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9PII7 Q9PII7]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9CJI1 Q9CJI1]
| |
| − | ** [http://www.uniprot.org/uniprot/P0A7D1 P0A7D1]
| |
| − | ** [http://www.uniprot.org/uniprot/Q59989 Q59989]
| |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: common-name=aminoacyl-trna hydrolase|peptidyl-trna hydrolase}} | |
| − | {{#set: ec-number=ec-3.1.1.29}} | |
| − | {{#set: nb gene associated=5}} | |
| − | {{#set: nb pathway associated=0}}
| |
| − | {{#set: reconstruction category=annotation|orthology}}
| |
| − | {{#set: reconstruction tool=pantograph|pathwaytools}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
| |
