Difference between revisions of "CPD-9854"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DNA-Combined-With-Exogenous-DNA == * common-name: ** dna combined with exogenous dna to form a recombinational junction == Reaction(s) kn...")
(Created page with "Category:metabolite == Metabolite CPD-9854 == * common-name: ** 3-(all-trans-heptaprenyl)benzene-1,2-diol * smiles: ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DNA-Combined-With-Exogenous-DNA ==
+
== Metabolite CPD-9854 ==
 
* common-name:
 
* common-name:
** dna combined with exogenous dna to form a recombinational junction
+
** 3-(all-trans-heptaprenyl)benzene-1,2-diol
 +
* smiles:
 +
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(o)c=cc=1))c)c)c)c)c)c
 +
* inchi-key:
 +
** ooykexozubwosx-nfdzfspwsa-n
 +
* molecular-weight:
 +
** 586.94
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.1.22.4-RXN]]
+
* [[RXN-9225]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dna combined with exogenous dna to form a recombinational junction}}
+
{{#set: common-name=3-(all-trans-heptaprenyl)benzene-1,2-diol}}
 +
{{#set: inchi-key=inchikey=ooykexozubwosx-nfdzfspwsa-n}}
 +
{{#set: molecular-weight=586.94}}

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-9854

  • common-name:
    • 3-(all-trans-heptaprenyl)benzene-1,2-diol
  • smiles:
    • cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(o)c=cc=1))c)c)c)c)c)c
  • inchi-key:
    • ooykexozubwosx-nfdzfspwsa-n
  • molecular-weight:
    • 586.94

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality