Difference between revisions of "CPD-9854"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Guanine26-in-tRNA == * common-name: ** a guanine26 in trna == Reaction(s) known to consume the compound == * RXN-12375 * [[RXN-12377]...") |
(Created page with "Category:metabolite == Metabolite CPD-9854 == * common-name: ** 3-(all-trans-heptaprenyl)benzene-1,2-diol * smiles: ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=...") |
||
| (5 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-9854 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-(all-trans-heptaprenyl)benzene-1,2-diol |
| + | * smiles: | ||
| + | ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(o)c=cc=1))c)c)c)c)c)c | ||
| + | * inchi-key: | ||
| + | ** ooykexozubwosx-nfdzfspwsa-n | ||
| + | * molecular-weight: | ||
| + | ** 586.94 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-9225]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-(all-trans-heptaprenyl)benzene-1,2-diol}} |
| + | {{#set: inchi-key=inchikey=ooykexozubwosx-nfdzfspwsa-n}} | ||
| + | {{#set: molecular-weight=586.94}} | ||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-9854
- common-name:
- 3-(all-trans-heptaprenyl)benzene-1,2-diol
- smiles:
- cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(o)c=cc=1))c)c)c)c)c)c
- inchi-key:
- ooykexozubwosx-nfdzfspwsa-n
- molecular-weight:
- 586.94
