Difference between revisions of "CPD-9854"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ15982 == * transcription-direction: ** negative * right-end-position: ** 163779 * left-end-position: ** 154241 * centisome-position: ** 53.471798...")
 
(Created page with "Category:metabolite == Metabolite CPD-9854 == * common-name: ** 3-(all-trans-heptaprenyl)benzene-1,2-diol * smiles: ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ15982 ==
+
== Metabolite CPD-9854 ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** 3-(all-trans-heptaprenyl)benzene-1,2-diol
−
* right-end-position:
+
* smiles:
−
** 163779
+
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(o)c=cc=1))c)c)c)c)c)c
−
* left-end-position:
+
* inchi-key:
−
** 154241
+
** ooykexozubwosx-nfdzfspwsa-n
−
* centisome-position:
+
* molecular-weight:
−
** 53.471798   
+
** 586.94
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-9225]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
== Reaction(s) of unknown directionality ==
−
* [[2.7.10.1-RXN]]
+
{{#set: common-name=3-(all-trans-heptaprenyl)benzene-1,2-diol}}
−
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=ooykexozubwosx-nfdzfspwsa-n}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=586.94}}
−
* [[2.7.11.24-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[2.7.12.1-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[2.7.12.2-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[PROTEIN-KINASE-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-14906]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-16317]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
</div>
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=163779}}
 
−
{{#set: left-end-position=154241}}
 
−
{{#set: centisome-position=53.471798    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=7}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-9854

  • common-name:
    • 3-(all-trans-heptaprenyl)benzene-1,2-diol
  • smiles:
    • cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(o)c=cc=1))c)c)c)c)c)c
  • inchi-key:
    • ooykexozubwosx-nfdzfspwsa-n
  • molecular-weight:
    • 586.94

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-9854&oldid=136809"