Difference between revisions of "CPD-9857"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-488 == * common-name: ** β-l-fucose 1-phosphate * smiles: ** cc1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1) * inchi-key: ** ptvxqarclqpg...")
(Created page with "Category:metabolite == Metabolite CPD-9857 == * common-name: ** 2-methoxy-6-(all-trans-heptaprenyl)phenol * smiles: ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-488 ==
+
== Metabolite CPD-9857 ==
 
* common-name:
 
* common-name:
** β-l-fucose 1-phosphate
+
** 2-methoxy-6-(all-trans-heptaprenyl)phenol
 
* smiles:
 
* smiles:
** cc1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1)
+
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(oc)c=cc=1))c)c)c)c)c)c
 
* inchi-key:
 
* inchi-key:
** ptvxqarclqpgir-sxuwkvjysa-l
+
** ywvpprxiddchcq-cuhbluqcsa-n
 
* molecular-weight:
 
* molecular-weight:
** 242.122
+
** 600.966
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[FUCOKINASE-RXN]]
+
* [[RXN-9225]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=β-l-fucose 1-phosphate}}
+
{{#set: common-name=2-methoxy-6-(all-trans-heptaprenyl)phenol}}
{{#set: inchi-key=inchikey=ptvxqarclqpgir-sxuwkvjysa-l}}
+
{{#set: inchi-key=inchikey=ywvpprxiddchcq-cuhbluqcsa-n}}
{{#set: molecular-weight=242.122}}
+
{{#set: molecular-weight=600.966}}

Revision as of 11:18, 15 January 2021

Metabolite CPD-9857

  • common-name:
    • 2-methoxy-6-(all-trans-heptaprenyl)phenol
  • smiles:
    • cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(oc)c=cc=1))c)c)c)c)c)c
  • inchi-key:
    • ywvpprxiddchcq-cuhbluqcsa-n
  • molecular-weight:
    • 600.966

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality