Difference between revisions of "CPD-9857"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12322 RXN-12322] == * direction: ** left-to-right * common-name: ** protein phosphatase methyle...")
(Created page with "Category:metabolite == Metabolite CPD-9857 == * common-name: ** 2-methoxy-6-(all-trans-heptaprenyl)phenol * smiles: ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12322 RXN-12322] ==
+
== Metabolite CPD-9857 ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** protein phosphatase methylesterase
+
** 2-methoxy-6-(all-trans-heptaprenyl)phenol
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/3.1.1.89 ec-3.1.1.89]
+
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(oc)c=cc=1))c)c)c)c)c)c
== Reaction formula ==
+
* inchi-key:
* 1 [[Phosphatase-2A-leucine-methyl-ester]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[METOH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[Phosphatase-2A-leucine]][c]
+
** ywvpprxiddchcq-cuhbluqcsa-n
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ00346]]
+
** 600.966
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) known to produce the compound ==
** Category: [[orthology]]
+
* [[RXN-9225]]
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) of unknown directionality ==
== Pathway(s) ==
+
{{#set: common-name=2-methoxy-6-(all-trans-heptaprenyl)phenol}}
== Reconstruction information  ==
+
{{#set: inchi-key=inchikey=ywvpprxiddchcq-cuhbluqcsa-n}}
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: molecular-weight=600.966}}
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
== External links  ==
 
* RHEA:
 
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=48549 48549]
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=protein phosphatase methylesterase}}
 
{{#set: ec-number=ec-3.1.1.89}}
 
{{#set: nb gene associated=1}}
 
{{#set: nb pathway associated=0}}
 
{{#set: reconstruction category=orthology|annotation}}
 
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=saccharina_japonica_genome|output_pantograph_ectocarpus_siliculosus}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-9857

  • common-name:
    • 2-methoxy-6-(all-trans-heptaprenyl)phenol
  • smiles:
    • cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(oc)c=cc=1))c)c)c)c)c)c
  • inchi-key:
    • ywvpprxiddchcq-cuhbluqcsa-n
  • molecular-weight:
    • 600.966

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality