Difference between revisions of "CPD-9857"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14227 RXN-14227] == * direction: ** left-to-right * common-name: ** 5'-nucleotidase * ec-number...")
(Created page with "Category:metabolite == Metabolite DELTA3-ISOPENTENYL-PP == * common-name: ** isopentenyl diphosphate * smiles: ** c=c(c)ccop([o-])(=o)op([o-])(=o)[o-] * inchi-key: ** nuhs...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14227 RXN-14227] ==
+
== Metabolite DELTA3-ISOPENTENYL-PP ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** 5'-nucleotidase
+
** isopentenyl diphosphate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/3.1.3.5 ec-3.1.3.5]
+
** c=c(c)ccop([o-])(=o)op([o-])(=o)[o-]
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[NICOTINATE_NUCLEOTIDE]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[CPD-8259]][c] '''+''' 1 [[Pi]][c]
+
** nuhsrofqtuxzqq-uhfffaoysa-k
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
** 243.069
−
* Gene: [[SJ16098]]
+
== Reaction(s) known to consume the compound ==
−
** Category: [[annotation]]
+
* [[FARNESYLTRANSTRANSFERASE-RXN]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[FPPS]]
−
** Category: [[orthology]]
+
* [[FPPSYN-RXN]]
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[GGPS]]
−
* Gene: [[SJ18895]]
+
* [[GPPS]]
−
** Category: [[annotation]]
+
* [[GPPSYN-RXN]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[IDI]]
−
* Gene: [[SJ18402]]
+
* [[IPPISOM-RXN]]
−
** Category: [[annotation]]
+
* [[RXN-10068]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-11486]]
−
** Category: [[orthology]]
+
* [[RXN-11488]]
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[RXN-11963]]
−
* Gene: [[SJ15366]]
+
* [[RXN-8999]]
−
** Category: [[annotation]]
+
* [[RXN-9969]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN0-5180]]
−
** Category: [[orthology]]
+
* [[TRANS-OCTAPRENYLTRANSTRANSFERASE-RXN]]
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
* Gene: [[SJ09030]]
+
* [[DIPHOSPHOMEVALONTE-DECARBOXYLASE-RXN]]
−
** Category: [[annotation]]
+
* [[GPPSYN-RXN]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[IDS1]]
−
</div>
+
* [[IPPISOM-RXN]]
−
== Pathway(s) ==
+
* [[ISPH2-RXN]]
−
== Reconstruction information  ==
+
* [[RXN-10068]]
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[RXN-11963]]
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
−
== External links  ==
+
{{#set: common-name=isopentenyl diphosphate}}
−
* RHEA:
+
{{#set: inchi-key=inchikey=nuhsrofqtuxzqq-uhfffaoysa-k}}
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=30938 30938]
+
{{#set: molecular-weight=243.069}}
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R03346 R03346]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=5'-nucleotidase}}
 
−
{{#set: ec-number=ec-3.1.3.5}}
 
−
{{#set: nb gene associated=5}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=annotation|orthology}}
 
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Revision as of 20:36, 18 December 2020

Metabolite DELTA3-ISOPENTENYL-PP

  • common-name:
    • isopentenyl diphosphate
  • smiles:
    • c=c(c)ccop([o-])(=o)op([o-])(=o)[o-]
  • inchi-key:
    • nuhsrofqtuxzqq-uhfffaoysa-k
  • molecular-weight:
    • 243.069

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-9857&oldid=47860"