Difference between revisions of "CPD-9857"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DELTA3-ISOPENTENYL-PP == * common-name: ** isopentenyl diphosphate * smiles: ** c=c(c)ccop([o-])(=o)op([o-])(=o)[o-] * inchi-key: ** nuhs...") |
(Created page with "Category:metabolite == Metabolite CPD-8529 == * smiles: ** c(ssc([r2])[r1])([r4])[r3] * common-name: ** r'c(r)s-s(r)cr' == Reaction(s) known to consume the compound == ==...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-8529 == |
+ | * smiles: | ||
+ | ** c(ssc([r2])[r1])([r4])[r3] | ||
* common-name: | * common-name: | ||
− | ** | + | ** r'c(r)s-s(r)cr' |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[THIOL-OXIDASE-RXN]] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=r'c(r)s-s(r)cr'}} |
− | |||
− |
Revision as of 14:58, 5 January 2021
Contents
Metabolite CPD-8529
- smiles:
- c(ssc([r2])[r1])([r4])[r3]
- common-name:
- r'c(r)s-s(r)cr'