Difference between revisions of "CPD-9858"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11938 == * common-name: ** 1d-myo-inositol 1,5-bis(diphosphate) 2,3,4,6-tetrakisphosphate * smiles: ** c1(op(=o)([o-])[o-])(c(op(=o)(...")
(Created page with "Category:metabolite == Metabolite Release-factor-L-glutamine == * common-name: ** a [release factor]-l-glutamine == Reaction(s) known to consume the compound == * RXN-14...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11938 ==
+
== Metabolite Release-factor-L-glutamine ==
 
* common-name:
 
* common-name:
** 1d-myo-inositol 1,5-bis(diphosphate) 2,3,4,6-tetrakisphosphate
+
** a [release factor]-l-glutamine
* smiles:
 
** c1(op(=o)([o-])[o-])(c(op(=o)([o-])[o-])c(op([o-])(=o)op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(op([o-])(=o)[o-])([o-])=o)c(op([o-])([o-])=o)1)
 
* inchi-key:
 
** hhqooerqsfjgep-slwywoedsa-a
 
* molecular-weight:
 
** 805.885
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10965]]
+
* [[RXN-14992]]
* [[RXN-10975]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.7.4.24-RXN]]
 
* [[RXN-10965]]
 
* [[RXN-10974]]
 
* [[RXN-10975]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1d-myo-inositol 1,5-bis(diphosphate) 2,3,4,6-tetrakisphosphate}}
+
{{#set: common-name=a [release factor]-l-glutamine}}
{{#set: inchi-key=inchikey=hhqooerqsfjgep-slwywoedsa-a}}
 
{{#set: molecular-weight=805.885}}
 

Revision as of 08:27, 15 March 2021

Metabolite Release-factor-L-glutamine

  • common-name:
    • a [release factor]-l-glutamine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [release factor]-l-glutamine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.