Difference between revisions of "CPD-9858"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ01604 == * transcription-direction: ** positive * right-end-position: ** 13911 * left-end-position: ** 5145 * centisome-position: ** 3.479243 =...")
 
(Created page with "Category:metabolite == Metabolite CPD-9858 == * common-name: ** 2-methoxy-6-all trans-heptaprenyl-1,4-benzoquinol * smiles: ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cc...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ01604 ==
+
== Metabolite CPD-9858 ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** 2-methoxy-6-all trans-heptaprenyl-1,4-benzoquinol
−
* right-end-position:
+
* smiles:
−
** 13911
+
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(=c(oc)c=c(c=1)o)o))c)c)c)c)c)c
−
* left-end-position:
+
* inchi-key:
−
** 5145
+
** wegxyvfdoluulo-tuumqracsa-n
−
* centisome-position:
+
* molecular-weight:
−
** 3.479243   
+
** 616.966
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-9227]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
== Reaction(s) of unknown directionality ==
−
* [[3.4.11.18-RXN]]
+
{{#set: common-name=2-methoxy-6-all trans-heptaprenyl-1,4-benzoquinol}}
−
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=wegxyvfdoluulo-tuumqracsa-n}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=616.966}}
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-17873]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-17874]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-17875]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-17876]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-17877]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-17878]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
</div>
 
−
== Pathway(s) associated ==
 
−
* [[PWY-7800]]
 
−
** '''6''' reactions found over '''21''' reactions in the full pathway
 
−
* [[PWY-7799]]
 
−
** '''7''' reactions found over '''14''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=13911}}
 
−
{{#set: left-end-position=5145}}
 
−
{{#set: centisome-position=3.479243    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=7}}
 
−
{{#set: nb pathway associated=2}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-9858

  • common-name:
    • 2-methoxy-6-all trans-heptaprenyl-1,4-benzoquinol
  • smiles:
    • cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(=c(oc)c=c(c=1)o)o))c)c)c)c)c)c
  • inchi-key:
    • wegxyvfdoluulo-tuumqracsa-n
  • molecular-weight:
    • 616.966

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-9858&oldid=138047"