Difference between revisions of "CPD-9858"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Propionyl-CoA-CO2-ligases == * common-name: ** [propionyl-coa:carbon-dioxide ligase (adp-forming)] == Reaction(s) known to consume the co...") |
(Created page with "Category:metabolite == Metabolite CPD-9858 == * common-name: ** 2-methoxy-6-all trans-heptaprenyl-1,4-benzoquinol * smiles: ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cc...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-9858 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2-methoxy-6-all trans-heptaprenyl-1,4-benzoquinol |
| + | * smiles: | ||
| + | ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(=c(oc)c=c(c=1)o)o))c)c)c)c)c)c | ||
| + | * inchi-key: | ||
| + | ** wegxyvfdoluulo-tuumqracsa-n | ||
| + | * molecular-weight: | ||
| + | ** 616.966 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-9227]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2-methoxy-6-all trans-heptaprenyl-1,4-benzoquinol}} |
| + | {{#set: inchi-key=inchikey=wegxyvfdoluulo-tuumqracsa-n}} | ||
| + | {{#set: molecular-weight=616.966}} | ||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-9858
- common-name:
- 2-methoxy-6-all trans-heptaprenyl-1,4-benzoquinol
- smiles:
- cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(=c(oc)c=c(c=1)o)o))c)c)c)c)c)c
- inchi-key:
- wegxyvfdoluulo-tuumqracsa-n
- molecular-weight:
- 616.966
