Difference between revisions of "CPD-9859"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.1.26.11-RXN 3.1.26.11-RXN] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy...") |
(Created page with "Category:metabolite == Metabolite CPD-9859 == * common-name: ** 6-methoxy-3-methyl-2-all-trans-heptaprenyl-1,4-benzoquinol * smiles: ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(...") |
||
| (9 intermediate revisions by 5 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-9859 == |
| − | * | + | * common-name: |
| − | ** | + | ** 6-methoxy-3-methyl-2-all-trans-heptaprenyl-1,4-benzoquinol |
| − | * | + | * smiles: |
| − | ** | + | ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(=c1c)o)o))c)c)c)c)c)c |
| − | == | + | * inchi-key: |
| − | + | ** rohkdmwqxdhldy-hohoqcmasa-n | |
| − | + | * molecular-weight: | |
| − | * | + | ** 630.993 |
| − | + | == Reaction(s) known to consume the compound == | |
| − | ** | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-9227]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=6-methoxy-3-methyl-2-all-trans-heptaprenyl-1,4-benzoquinol}} | |
| − | * | + | {{#set: inchi-key=inchikey=rohkdmwqxdhldy-hohoqcmasa-n}} |
| − | + | {{#set: molecular-weight=630.993}} | |
| − | |||
| − | |||
| − | |||
| − | ** | ||
| − | == | ||
| − | == | ||
| − | * | ||
| − | == | ||
| − | {{#set: | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-9859
- common-name:
- 6-methoxy-3-methyl-2-all-trans-heptaprenyl-1,4-benzoquinol
- smiles:
- cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(=c1c)o)o))c)c)c)c)c)c
- inchi-key:
- rohkdmwqxdhldy-hohoqcmasa-n
- molecular-weight:
- 630.993
