Difference between revisions of "CPD-9865"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite carboxybiotin-L-lysine-in-BCCP-dimers == * common-name: ** a [carboxyl-carrier protein dimer]-n6-carboxybiotinyl-l-lysine == Reaction(s)...")
(Created page with "Category:metabolite == Metabolite CPD-9865 == * common-name: ** 6-(all-trans-decaprenyl)-2-methoxy-phenol * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite carboxybiotin-L-lysine-in-BCCP-dimers ==
+
== Metabolite CPD-9865 ==
 
* common-name:
 
* common-name:
** a [carboxyl-carrier protein dimer]-n6-carboxybiotinyl-l-lysine
+
** 6-(all-trans-decaprenyl)-2-methoxy-phenol
 +
* smiles:
 +
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(oc)c=cc=1))c)c)c)c)c)c)c)c)c)c
 +
* inchi-key:
 +
** fyllwsgfaaqkhu-gbbrockzsa-n
 +
* molecular-weight:
 +
** 805.321
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-5055]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[BIOTIN-CARBOXYL-RXN]]
+
* [[RXN-9233]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [carboxyl-carrier protein dimer]-n6-carboxybiotinyl-l-lysine}}
+
{{#set: common-name=6-(all-trans-decaprenyl)-2-methoxy-phenol}}
 +
{{#set: inchi-key=inchikey=fyllwsgfaaqkhu-gbbrockzsa-n}}
 +
{{#set: molecular-weight=805.321}}

Latest revision as of 11:12, 18 March 2021

Metabolite CPD-9865

  • common-name:
    • 6-(all-trans-decaprenyl)-2-methoxy-phenol
  • smiles:
    • cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(oc)c=cc=1))c)c)c)c)c)c)c)c)c)c
  • inchi-key:
    • fyllwsgfaaqkhu-gbbrockzsa-n
  • molecular-weight:
    • 805.321

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality