Difference between revisions of "CPD-9866"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7224 == * common-name: ** n-acetyl-l-citrulline * smiles: ** cc(=o)nc(c([o-])=o)cccnc(=o)n * inchi-key: ** wmqmioyqxnrroc-lurjtmiesa-...")
(Created page with "Category:metabolite == Metabolite CPD-9866 == * common-name: ** 2-methoxy-6-(all-trans-nonaprenyl)phenol * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=c...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-7224 ==
+
== Metabolite CPD-9866 ==
 
* common-name:
 
* common-name:
** n-acetyl-l-citrulline
+
** 2-methoxy-6-(all-trans-nonaprenyl)phenol
 
* smiles:
 
* smiles:
** cc(=o)nc(c([o-])=o)cccnc(=o)n
+
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(oc)c=cc=1))c)c)c)c)c)c)c)c)c
 
* inchi-key:
 
* inchi-key:
** wmqmioyqxnrroc-lurjtmiesa-m
+
** xryxraoxvpwhhk-ssrazkmssa-n
 
* molecular-weight:
 
* molecular-weight:
** 216.216
+
** 737.203
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7933]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-9240]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n-acetyl-l-citrulline}}
+
{{#set: common-name=2-methoxy-6-(all-trans-nonaprenyl)phenol}}
{{#set: inchi-key=inchikey=wmqmioyqxnrroc-lurjtmiesa-m}}
+
{{#set: inchi-key=inchikey=xryxraoxvpwhhk-ssrazkmssa-n}}
{{#set: molecular-weight=216.216}}
+
{{#set: molecular-weight=737.203}}

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-9866

  • common-name:
    • 2-methoxy-6-(all-trans-nonaprenyl)phenol
  • smiles:
    • cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(oc)c=cc=1))c)c)c)c)c)c)c)c)c
  • inchi-key:
    • xryxraoxvpwhhk-ssrazkmssa-n
  • molecular-weight:
    • 737.203

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality