Difference between revisions of "CPD-9866"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PHOSPHORYL-ETHANOLAMINE == * common-name: ** o-phosphoethanolamine * smiles: ** c(c[n+])op([o-])([o-])=o * inchi-key: ** suhootkupisobe-u...")
(Created page with "Category:metabolite == Metabolite CPD-9866 == * common-name: ** 2-methoxy-6-(all-trans-nonaprenyl)phenol * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=c...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PHOSPHORYL-ETHANOLAMINE ==
+
== Metabolite CPD-9866 ==
 
* common-name:
 
* common-name:
** o-phosphoethanolamine
+
** 2-methoxy-6-(all-trans-nonaprenyl)phenol
 
* smiles:
 
* smiles:
** c(c[n+])op([o-])([o-])=o
+
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(oc)c=cc=1))c)c)c)c)c)c)c)c)c
 
* inchi-key:
 
* inchi-key:
** suhootkupisobe-uhfffaoysa-m
+
** xryxraoxvpwhhk-ssrazkmssa-n
 
* molecular-weight:
 
* molecular-weight:
** 140.055
+
** 737.203
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.7.7.14-RXN]]
 
* [[RXN-7948]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ETHANOLAMINE-KINASE-RXN]]
+
* [[RXN-9240]]
* [[RXN-13729]]
 
* [[RXN3DJ-11230]]
 
* [[SGPL11]]
 
* [[SPHINGANINE-1-PHOSPHATE-ALDOLASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=o-phosphoethanolamine}}
+
{{#set: common-name=2-methoxy-6-(all-trans-nonaprenyl)phenol}}
{{#set: inchi-key=inchikey=suhootkupisobe-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=xryxraoxvpwhhk-ssrazkmssa-n}}
{{#set: molecular-weight=140.055}}
+
{{#set: molecular-weight=737.203}}

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-9866

  • common-name:
    • 2-methoxy-6-(all-trans-nonaprenyl)phenol
  • smiles:
    • cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(oc)c=cc=1))c)c)c)c)c)c)c)c)c
  • inchi-key:
    • xryxraoxvpwhhk-ssrazkmssa-n
  • molecular-weight:
    • 737.203

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality